C10H14BrN3O2 — CID 77069982
3-(2-bromo-5-methoxyanilino)-N'-hydroxypropanimidamide (PubChem CID 77069982) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. Its IUPAC name is 3-(2-bromo-5-methoxyanilino)-N'-hydroxypropanimidamide.
| Compound Name | 3-(2-bromo-5-methoxyanilino)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77069982 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-(2-bromo-5-methoxyanilino)-N'-hydroxypropanimidamide |
| SMILES | COc1ccc(Br)c(NCCC(N)=NO)c1 |
| InChI | InChI=1S/C10H14BrN3O2/c1-16-7-2-3-8(11)9(6-7)13-5-4-10(12)14-15/h2-3,6,13,15H,4-5H2,1H3,(H2,12,14) |
| InChIKey | HTKGDCGWQQXKTG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|