About 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide
5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide (PubChem CID 77032478) has the molecular formula C11H15Br2N3O
and a molecular weight of 365.07 g/mol. Its IUPAC name is 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide |
| PubChem CID | 77032478 |
| Molecular Formula | C11H15Br2N3O |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide |
| SMILES | NC(CCCCNc1cc(Br)ccc1Br)=NO |
| InChI | InChI=1S/C11H15Br2N3O/c12-8-4-5-9(13)10(7-8)15-6-2-1-3-11(14)16-17/h4-5,7,15,17H,1-3,6H2,(H2,14,16) |
| InChIKey | XHYAEGFFLMXDRV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide?
The IUPAC name of 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide (CID 77032478) is 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide.
What is the SMILES notation for 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide?
The canonical SMILES for 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide is NC(CCCCNc1cc(Br)ccc1Br)=NO.
What is the InChIKey of 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide?
The InChIKey is XHYAEGFFLMXDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Br2N3O/c12-8-4-5-9(13)10(7-8)15-6-2-1-3-11(14)16-17/h4-5,7,15,17H,1-3,6H2,(H2,14,16).
What are the key properties of 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide?
5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide has a molecular weight of 365.07 g/mol, XLogP of 3.54, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dibromoanilino)-N'-hydroxypentanimidamide is sourced from PubChem (CID 77032478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).