C16H25Br2N — CID 63492917
2,5-dibromo-N-decylaniline (PubChem CID 63492917) has the molecular formula C16H25Br2N and a molecular weight of 391.19 g/mol. Its IUPAC name is 2,5-dibromo-N-decylaniline.
| Compound Name | 2,5-dibromo-N-decylaniline |
|---|---|
| PubChem CID | 63492917 |
| Molecular Formula | C16H25Br2N |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2,5-dibromo-N-decylaniline |
| SMILES | CCCCCCCCCCNc1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H25Br2N/c1-2-3-4-5-6-7-8-9-12-19-16-13-14(17)10-11-15(16)18/h10-11,13,19H,2-9,12H2,1H3 |
| InChIKey | YSTQDPTUIQCXSH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|