C18H30Br2N2 — CID 132917339
2,5-dibromo-1-N,4-N-dihexylbenzene-1,4-diamine (PubChem CID 132917339) has the molecular formula C18H30Br2N2 and a molecular weight of 434.26 g/mol. Its IUPAC name is 2,5-dibromo-1-N,4-N-dihexylbenzene-1,4-diamine.
| Compound Name | 2,5-dibromo-1-N,4-N-dihexylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 132917339 |
| Molecular Formula | C18H30Br2N2 |
| Molecular Weight | 434.26 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2,5-dibromo-1-N,4-N-dihexylbenzene-1,4-diamine |
| SMILES | CCCCCCNc1cc(Br)c(NCCCCCC)cc1Br |
| InChI | InChI=1S/C18H30Br2N2/c1-3-5-7-9-11-21-17-13-16(20)18(14-15(17)19)22-12-10-8-6-4-2/h13-14,21-22H,3-12H2,1-2H3 |
| InChIKey | PJQBPCRIDBZPJO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.26 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|