C13H19Br2NO — CID 103411588
2,4-dibromo-N-hexyl-5-methoxyaniline (PubChem CID 103411588) has the molecular formula C13H19Br2NO and a molecular weight of 365.11 g/mol. Its IUPAC name is 2,4-dibromo-N-hexyl-5-methoxyaniline.
| Compound Name | 2,4-dibromo-N-hexyl-5-methoxyaniline |
|---|---|
| PubChem CID | 103411588 |
| Molecular Formula | C13H19Br2NO |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 2,4-dibromo-N-hexyl-5-methoxyaniline |
| SMILES | CCCCCCNc1cc(OC)c(Br)cc1Br |
| InChI | InChI=1S/C13H19Br2NO/c1-3-4-5-6-7-16-12-9-13(17-2)11(15)8-10(12)14/h8-9,16H,3-7H2,1-2H3 |
| InChIKey | VCSPGTUUPFBRFQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|