C10H10Br2N2O — CID 103412664
3-(2,4-dibromo-5-methoxyanilino)propanenitrile (PubChem CID 103412664) has the molecular formula C10H10Br2N2O and a molecular weight of 334.01 g/mol. Its IUPAC name is 3-(2,4-dibromo-5-methoxyanilino)propanenitrile.
| Compound Name | 3-(2,4-dibromo-5-methoxyanilino)propanenitrile |
|---|---|
| PubChem CID | 103412664 |
| Molecular Formula | C10H10Br2N2O |
| Molecular Weight | 334.01 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 3-(2,4-dibromo-5-methoxyanilino)propanenitrile |
| SMILES | COc1cc(NCCC#N)c(Br)cc1Br |
| InChI | InChI=1S/C10H10Br2N2O/c1-15-10-6-9(14-4-2-3-13)7(11)5-8(10)12/h5-6,14H,2,4H2,1H3 |
| InChIKey | BDBNEIOBIMKUEW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.01 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|