C14H13BrN4O — CID 116975700
3-[[5-(3-bromo-4-methoxyphenyl)pyrimidin-2-yl]amino]propanenitrile (PubChem CID 116975700) has the molecular formula C14H13BrN4O and a molecular weight of 333.19 g/mol. Its IUPAC name is 3-[[5-(3-bromo-4-methoxyphenyl)pyrimidin-2-yl]amino]propanenitrile.
| Compound Name | 3-[[5-(3-bromo-4-methoxyphenyl)pyrimidin-2-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 116975700 |
| Molecular Formula | C14H13BrN4O |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 3-[[5-(3-bromo-4-methoxyphenyl)pyrimidin-2-yl]amino]propanenitrile |
| SMILES | COc1ccc(-c2cnc(NCCC#N)nc2)cc1Br |
| InChI | InChI=1S/C14H13BrN4O/c1-20-13-4-3-10(7-12(13)15)11-8-18-14(19-9-11)17-6-2-5-16/h3-4,7-9H,2,6H2,1H3,(H,17,18,19) |
| InChIKey | CWNVQYBAJUMPAP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|