C14H16N6O2 — CID 23535836
3-[[4-(3,4-dimethoxyanilino)-1,3,5-triazin-2-yl]amino]propanenitrile (PubChem CID 23535836) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-[[4-(3,4-dimethoxyanilino)-1,3,5-triazin-2-yl]amino]propanenitrile.
| Compound Name | 3-[[4-(3,4-dimethoxyanilino)-1,3,5-triazin-2-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 23535836 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[[4-(3,4-dimethoxyanilino)-1,3,5-triazin-2-yl]amino]propanenitrile |
| SMILES | COc1ccc(Nc2ncnc(NCCC#N)n2)cc1OC |
| InChI | InChI=1S/C14H16N6O2/c1-21-11-5-4-10(8-12(11)22-2)19-14-18-9-17-13(20-14)16-7-3-6-15/h4-5,8-9H,3,7H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | BCIRJGCSUIKGBH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|