C19H21N5O4 — CID 23535780
2-methyl-5-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 23535780) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-methyl-5-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 2-methyl-5-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 23535780 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-methyl-5-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | COc1cc(Nc2ncnc(Nc3ccc(C)c(O)c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N5O4/c1-11-5-6-12(7-14(11)25)22-18-20-10-21-19(24-18)23-13-8-15(26-2)17(28-4)16(9-13)27-3/h5-10,25H,1-4H3,(H2,20,21,22,23,24) |
| InChIKey | LGSJBDPGMBNTQC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |