C22H21N5O4 — CID 23536133
5-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]methyl]quinolin-8-ol (PubChem CID 23536133) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 5-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]methyl]quinolin-8-ol.
| Compound Name | 5-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 23536133 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]methyl]quinolin-8-ol |
| SMILES | COc1cc(Nc2ncnc(Cc3ccc(O)c4ncccc34)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N5O4/c1-29-17-10-14(11-18(30-2)21(17)31-3)26-22-25-12-24-19(27-22)9-13-6-7-16(28)20-15(13)5-4-8-23-20/h4-8,10-12,28H,9H2,1-3H3,(H,24,25,26,27) |
| InChIKey | RTVTWFLTWDQNKB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |