C21H23N6O3P — CID 142056646
4-N-[1-(phosphanylmethyl)indol-5-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 142056646) has the molecular formula C21H23N6O3P and a molecular weight of 438.43 g/mol. Its IUPAC name is 4-N-[1-(phosphanylmethyl)indol-5-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[1-(phosphanylmethyl)indol-5-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 142056646 |
| Molecular Formula | C21H23N6O3P |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 4-N-[1-(phosphanylmethyl)indol-5-yl]-2-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(Nc2ncnc(Nc3ccc4c(ccn4CP)c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H23N6O3P/c1-28-17-9-15(10-18(29-2)19(17)30-3)25-21-23-11-22-20(26-21)24-14-4-5-16-13(8-14)6-7-27(16)12-31/h4-11H,12,31H2,1-3H3,(H2,22,23,24,25,26) |
| InChIKey | NLJTZYCCKVOFKT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|