C19H17ClN6O3 — CID 23535996
4-(3-chloroindazol-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 23535996) has the molecular formula C19H17ClN6O3 and a molecular weight of 412.84 g/mol. Its IUPAC name is 4-(3-chloroindazol-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-chloroindazol-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23535996 |
| Molecular Formula | C19H17ClN6O3 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 4-(3-chloroindazol-1-yl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(Nc2ncnc(-n3nc(Cl)c4ccccc43)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H17ClN6O3/c1-27-14-8-11(9-15(28-2)16(14)29-3)23-18-21-10-22-19(24-18)26-13-7-5-4-6-12(13)17(20)25-26/h4-10H,1-3H3,(H,21,22,23,24) |
| InChIKey | ZIGJIJFKOLSNMU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |