C22H23N7O3 — CID 23536696
N-prop-2-enyl-1-[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine (PubChem CID 23536696) has the molecular formula C22H23N7O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-prop-2-enyl-1-[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine.
| Compound Name | N-prop-2-enyl-1-[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 23536696 |
| Molecular Formula | C22H23N7O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-prop-2-enyl-1-[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine |
| SMILES | C=CCNc1nc2ccccc2n1-c1ncnc(Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C22H23N7O3/c1-5-10-23-21-27-15-8-6-7-9-16(15)29(21)22-25-13-24-20(28-22)26-14-11-17(30-2)19(32-4)18(12-14)31-3/h5-9,11-13H,1,10H2,2-4H3,(H,23,27)(H,24,25,26,28) |
| InChIKey | MKQUKTFHEMEGGU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 108.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|