C27H25N7O5 — CID 23536704
N-(1,3-benzodioxol-5-ylmethyl)-1-[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine (PubChem CID 23536704) has the molecular formula C27H25N7O5 and a molecular weight of 527.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1-[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1-[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 23536704 |
| Molecular Formula | C27H25N7O5 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1-[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]benzimidazol-2-amine |
| SMILES | COc1cc(Nc2ncnc(-n3c(NCc4ccc5c(c4)OCO5)nc4ccccc43)n2)cc(OC)c1OC |
| InChI | InChI=1S/C27H25N7O5/c1-35-22-11-17(12-23(36-2)24(22)37-3)31-25-29-14-30-27(33-25)34-19-7-5-4-6-18(19)32-26(34)28-13-16-8-9-20-21(10-16)39-15-38-20/h4-12,14H,13,15H2,1-3H3,(H,28,32)(H,29,30,31,33) |
| InChIKey | AUJJHZINOLJTAO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |