C20H21N3O6 — CID 21184047
N-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetramethoxyquinazolin-2-amine (PubChem CID 21184047) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetramethoxyquinazolin-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetramethoxyquinazolin-2-amine |
|---|---|
| PubChem CID | 21184047 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4,6,7,8-tetramethoxyquinazolin-2-amine |
| SMILES | COc1cc2c(OC)nc(NCc3ccc4c(c3)OCO4)nc2c(OC)c1OC |
| InChI | InChI=1S/C20H21N3O6/c1-24-15-8-12-16(18(26-3)17(15)25-2)22-20(23-19(12)27-4)21-9-11-5-6-13-14(7-11)29-10-28-13/h5-8H,9-10H2,1-4H3,(H,21,22,23) |
| InChIKey | IANWOHAKXQSZRC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |