C21H23N3O5 — CID 150246554
4-[3-(1,3-benzodioxol-5-yl)propyl]-6,7,8-trimethoxyquinazolin-2-amine (PubChem CID 150246554) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-yl)propyl]-6,7,8-trimethoxyquinazolin-2-amine.
| Compound Name | 4-[3-(1,3-benzodioxol-5-yl)propyl]-6,7,8-trimethoxyquinazolin-2-amine |
|---|---|
| PubChem CID | 150246554 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-yl)propyl]-6,7,8-trimethoxyquinazolin-2-amine |
| SMILES | COc1cc2c(CCCc3ccc4c(c3)OCO4)nc(N)nc2c(OC)c1OC |
| InChI | InChI=1S/C21H23N3O5/c1-25-17-10-13-14(23-21(22)24-18(13)20(27-3)19(17)26-2)6-4-5-12-7-8-15-16(9-12)29-11-28-15/h7-10H,4-6,11H2,1-3H3,(H2,22,23,24) |
| InChIKey | FYQCOHSNVNVXTN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |