About 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine
6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine (PubChem CID 123826343) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine |
| PubChem CID | 123826343 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine |
| SMILES | Nc1ncnc2ccc(CCCc3ccc4c(c3)OCO4)cc12 |
| InChI | InChI=1S/C18H17N3O2/c19-18-14-8-12(4-6-15(14)20-10-21-18)2-1-3-13-5-7-16-17(9-13)23-11-22-16/h4-10H,1-3,11H2,(H2,19,20,21) |
| InChIKey | XBGQXWHALQFFJT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine?
The IUPAC name of 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine (CID 123826343) is 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine.
What is the SMILES notation for 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine?
The canonical SMILES for 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine is Nc1ncnc2ccc(CCCc3ccc4c(c3)OCO4)cc12.
What is the InChIKey of 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine?
The InChIKey is XBGQXWHALQFFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c19-18-14-8-12(4-6-15(14)20-10-21-18)2-1-3-13-5-7-16-17(9-13)23-11-22-16/h4-10H,1-3,11H2,(H2,19,20,21).
What are the key properties of 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine?
6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine has a molecular weight of 307.35 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(1,3-benzodioxol-5-yl)propyl]quinazolin-4-amine is sourced from PubChem (CID 123826343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).