C17H13N3O4 — CID 10448853
N-(1,3-benzodioxol-5-ylmethyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine (PubChem CID 10448853) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
|---|---|
| PubChem CID | 10448853 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
| SMILES | c1nc(NCc2ccc3c(c2)OCO3)c2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C17H13N3O4/c1-2-13-14(22-8-21-13)3-10(1)6-18-17-11-4-15-16(24-9-23-15)5-12(11)19-7-20-17/h1-5,7H,6,8-9H2,(H,18,19,20) |
| InChIKey | FKQAXLINOJNNLE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |