C16H21N5O3 — CID 22542548
4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine (PubChem CID 22542548) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22542548 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine |
| SMILES | COCCCNc1ncnc(NCc2ccc3c(c2)OCO3)c1N |
| InChI | InChI=1S/C16H21N5O3/c1-22-6-2-5-18-15-14(17)16(21-9-20-15)19-8-11-3-4-12-13(7-11)24-10-23-12/h3-4,7,9H,2,5-6,8,10,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | YBZKNDUPJBSYKK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|