C18H23N5O2 — CID 22542509
6-(azepan-1-yl)-4-N-(1,3-benzodioxol-5-ylmethyl)pyrimidine-4,5-diamine (PubChem CID 22542509) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 6-(azepan-1-yl)-4-N-(1,3-benzodioxol-5-ylmethyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(azepan-1-yl)-4-N-(1,3-benzodioxol-5-ylmethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22542509 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 6-(azepan-1-yl)-4-N-(1,3-benzodioxol-5-ylmethyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(NCc2ccc3c(c2)OCO3)ncnc1N1CCCCCC1 |
| InChI | InChI=1S/C18H23N5O2/c19-16-17(20-10-13-5-6-14-15(9-13)25-12-24-14)21-11-22-18(16)23-7-3-1-2-4-8-23/h5-6,9,11H,1-4,7-8,10,12,19H2,(H,20,21,22) |
| InChIKey | GCOCGIANCOBPAF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |