C18H16N4O3 — CID 22542630
4-N-(1,3-benzodioxol-5-ylmethyl)-6-phenoxypyrimidine-4,5-diamine (PubChem CID 22542630) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-6-phenoxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-phenoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22542630 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-phenoxypyrimidine-4,5-diamine |
| SMILES | Nc1c(NCc2ccc3c(c2)OCO3)ncnc1Oc1ccccc1 |
| InChI | InChI=1S/C18H16N4O3/c19-16-17(20-9-12-6-7-14-15(8-12)24-11-23-14)21-10-22-18(16)25-13-4-2-1-3-5-13/h1-8,10H,9,11,19H2,(H,20,21,22) |
| InChIKey | MLTJFBZTRJXJGP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |