C22H24N4O2 — CID 21002637
4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-6-ethylquinazoline (PubChem CID 21002637) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-6-ethylquinazoline.
| Compound Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-6-ethylquinazoline |
|---|---|
| PubChem CID | 21002637 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-6-ethylquinazoline |
| SMILES | CCc1ccc2ncnc(N3CCN(Cc4ccc5c(c4)OCO5)CC3)c2c1 |
| InChI | InChI=1S/C22H24N4O2/c1-2-16-3-5-19-18(11-16)22(24-14-23-19)26-9-7-25(8-10-26)13-17-4-6-20-21(12-17)28-15-27-20/h3-6,11-12,14H,2,7-10,13,15H2,1H3 |
| InChIKey | SRIPFQYWBRNIHX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |