C22H29N5O2 — CID 112863027
1-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyrimidin-4-yl]azepane (PubChem CID 112863027) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyrimidin-4-yl]azepane.
| Compound Name | 1-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyrimidin-4-yl]azepane |
|---|---|
| PubChem CID | 112863027 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 1-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyrimidin-4-yl]azepane |
| SMILES | c1nc(N2CCCCCC2)cc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)n1 |
| InChI | InChI=1S/C22H29N5O2/c1-2-4-8-26(7-3-1)21-14-22(24-16-23-21)27-11-9-25(10-12-27)15-18-5-6-19-20(13-18)29-17-28-19/h5-6,13-14,16H,1-4,7-12,15,17H2 |
| InChIKey | UOWDWGRWGFAECU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |