C19H24ClN5 — CID 154575798
4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6-pyrrolidin-1-ylpyrimidine (PubChem CID 154575798) has the molecular formula C19H24ClN5 and a molecular weight of 357.89 g/mol. Its IUPAC name is 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6-pyrrolidin-1-ylpyrimidine.
| Compound Name | 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 154575798 |
| Molecular Formula | C19H24ClN5 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6-pyrrolidin-1-ylpyrimidine |
| SMILES | Clc1ccc(CN2CCN(c3cc(N4CCCC4)ncn3)CC2)cc1 |
| InChI | InChI=1S/C19H24ClN5/c20-17-5-3-16(4-6-17)14-23-9-11-25(12-10-23)19-13-18(21-15-22-19)24-7-1-2-8-24/h3-6,13,15H,1-2,7-12,14H2 |
| InChIKey | YMQBXRVOAUUJCO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |