C19H21ClN6 — CID 166601673
4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-6-(3-methylpyrazol-1-yl)pyrimidine (PubChem CID 166601673) has the molecular formula C19H21ClN6 and a molecular weight of 368.87 g/mol. Its IUPAC name is 4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-6-(3-methylpyrazol-1-yl)pyrimidine.
| Compound Name | 4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-6-(3-methylpyrazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 166601673 |
| Molecular Formula | C19H21ClN6 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-6-(3-methylpyrazol-1-yl)pyrimidine |
| SMILES | Cc1ccn(-c2cc(N3CCN(Cc4cccc(Cl)c4)CC3)ncn2)n1 |
| InChI | InChI=1S/C19H21ClN6/c1-15-5-6-26(23-15)19-12-18(21-14-22-19)25-9-7-24(8-10-25)13-16-3-2-4-17(20)11-16/h2-6,11-12,14H,7-10,13H2,1H3 |
| InChIKey | HTBSUCPTHXRHFU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |