C19H20ClFN6 — CID 166601695
4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-6-(3-methylpyrazol-1-yl)pyrimidine (PubChem CID 166601695) has the molecular formula C19H20ClFN6 and a molecular weight of 386.86 g/mol. Its IUPAC name is 4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-6-(3-methylpyrazol-1-yl)pyrimidine.
| Compound Name | 4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-6-(3-methylpyrazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 166601695 |
| Molecular Formula | C19H20ClFN6 |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-6-(3-methylpyrazol-1-yl)pyrimidine |
| SMILES | Cc1ccn(-c2cc(N3CCN(Cc4c(F)cccc4Cl)CC3)ncn2)n1 |
| InChI | InChI=1S/C19H20ClFN6/c1-14-5-6-27(24-14)19-11-18(22-13-23-19)26-9-7-25(8-10-26)12-15-16(20)3-2-4-17(15)21/h2-6,11,13H,7-10,12H2,1H3 |
| InChIKey | VIFIWWWHSQCPAU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |