C18H18F3N7 — CID 166601638
4-(3-methylpyrazol-1-yl)-6-[4-[6-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidine (PubChem CID 166601638) has the molecular formula C18H18F3N7 and a molecular weight of 389.39 g/mol. Its IUPAC name is 4-(3-methylpyrazol-1-yl)-6-[4-[6-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidine.
| Compound Name | 4-(3-methylpyrazol-1-yl)-6-[4-[6-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 166601638 |
| Molecular Formula | C18H18F3N7 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 4-(3-methylpyrazol-1-yl)-6-[4-[6-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidine |
| SMILES | Cc1ccn(-c2cc(N3CCN(c4cccc(C(F)(F)F)n4)CC3)ncn2)n1 |
| InChI | InChI=1S/C18H18F3N7/c1-13-5-6-28(25-13)17-11-16(22-12-23-17)27-9-7-26(8-10-27)15-4-2-3-14(24-15)18(19,20)21/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | FPQSJGCFHHPZAV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |