C18H20N6 — CID 10805650
4-(4-benzylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidine (PubChem CID 10805650) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidine |
|---|---|
| PubChem CID | 10805650 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidine |
| SMILES | c1ccc(CN2CCN(c3cc(-n4cccn4)ncn3)CC2)cc1 |
| InChI | InChI=1S/C18H20N6/c1-2-5-16(6-3-1)14-22-9-11-23(12-10-22)17-13-18(20-15-19-17)24-8-4-7-21-24/h1-8,13,15H,9-12,14H2 |
| InChIKey | MQMAKYIGIFXTQJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |