C20H21N5 — CID 58273412
4-phenyl-6-[4-(pyridin-4-ylmethyl)piperazin-1-yl]pyrimidine (PubChem CID 58273412) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-phenyl-6-[4-(pyridin-4-ylmethyl)piperazin-1-yl]pyrimidine.
| Compound Name | 4-phenyl-6-[4-(pyridin-4-ylmethyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 58273412 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-phenyl-6-[4-(pyridin-4-ylmethyl)piperazin-1-yl]pyrimidine |
| SMILES | c1ccc(-c2cc(N3CCN(Cc4ccncc4)CC3)ncn2)cc1 |
| InChI | InChI=1S/C20H21N5/c1-2-4-18(5-3-1)19-14-20(23-16-22-19)25-12-10-24(11-13-25)15-17-6-8-21-9-7-17/h1-9,14,16H,10-13,15H2 |
| InChIKey | RMYYENOUELEXQQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |