C21H22N4O2S — CID 20933367
4-(4-benzylsulfonylpiperazin-1-yl)-6-phenylpyrimidine (PubChem CID 20933367) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 4-(4-benzylsulfonylpiperazin-1-yl)-6-phenylpyrimidine.
| Compound Name | 4-(4-benzylsulfonylpiperazin-1-yl)-6-phenylpyrimidine |
|---|---|
| PubChem CID | 20933367 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-(4-benzylsulfonylpiperazin-1-yl)-6-phenylpyrimidine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCN(c2cc(-c3ccccc3)ncn2)CC1 |
| InChI | InChI=1S/C21H22N4O2S/c26-28(27,16-18-7-3-1-4-8-18)25-13-11-24(12-14-25)21-15-20(22-17-23-21)19-9-5-2-6-10-19/h1-10,15,17H,11-14,16H2 |
| InChIKey | YZRLJZGZDXMJPL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |