C22H23ClN4O2S — CID 90517059
4-[4-(4-chloro-2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-6-phenylpyrimidine (PubChem CID 90517059) has the molecular formula C22H23ClN4O2S and a molecular weight of 442.97 g/mol. Its IUPAC name is 4-[4-(4-chloro-2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-6-phenylpyrimidine.
| Compound Name | 4-[4-(4-chloro-2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 90517059 |
| Molecular Formula | C22H23ClN4O2S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 4-[4-(4-chloro-2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-6-phenylpyrimidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(c3cc(-c4ccccc4)ncn3)CC2)c(C)cc1Cl |
| InChI | InChI=1S/C22H23ClN4O2S/c1-16-13-21(17(2)12-19(16)23)30(28,29)27-10-8-26(9-11-27)22-14-20(24-15-25-22)18-6-4-3-5-7-18/h3-7,12-15H,8-11H2,1-2H3 |
| InChIKey | WNIIKZWDJWKTTJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |