C21H20Cl2N4O3S — CID 90517170
4-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine (PubChem CID 90517170) has the molecular formula C21H20Cl2N4O3S and a molecular weight of 479.39 g/mol. Its IUPAC name is 4-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine.
| Compound Name | 4-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 90517170 |
| Molecular Formula | C21H20Cl2N4O3S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 4-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-6-(4-methoxyphenyl)pyrimidine |
| SMILES | COc1ccc(-c2cc(N3CCN(S(=O)(=O)c4cccc(Cl)c4Cl)CC3)ncn2)cc1 |
| InChI | InChI=1S/C21H20Cl2N4O3S/c1-30-16-7-5-15(6-8-16)18-13-20(25-14-24-18)26-9-11-27(12-10-26)31(28,29)19-4-2-3-17(22)21(19)23/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | ZKQLQDQYEGNLFC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |