C21H21ClN4O3S — CID 53071556
4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-6-(3-methoxyphenyl)pyrimidine (PubChem CID 53071556) has the molecular formula C21H21ClN4O3S and a molecular weight of 444.94 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-6-(3-methoxyphenyl)pyrimidine.
| Compound Name | 4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-6-(3-methoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 53071556 |
| Molecular Formula | C21H21ClN4O3S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-6-(3-methoxyphenyl)pyrimidine |
| SMILES | COc1cccc(-c2cc(N3CCN(S(=O)(=O)c4cccc(Cl)c4)CC3)ncn2)c1 |
| InChI | InChI=1S/C21H21ClN4O3S/c1-29-18-6-2-4-16(12-18)20-14-21(24-15-23-20)25-8-10-26(11-9-25)30(27,28)19-7-3-5-17(22)13-19/h2-7,12-15H,8-11H2,1H3 |
| InChIKey | FDGMQVWNJFGJKJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |