C24H28N4O3S — CID 53071564
4-(3-methoxyphenyl)-6-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 53071564) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-6-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-(3-methoxyphenyl)-6-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 53071564 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 4-(3-methoxyphenyl)-6-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN(c3cc(-c4cccc(OC)c4)ncn3)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O3S/c1-3-5-19-8-10-22(11-9-19)32(29,30)28-14-12-27(13-15-28)24-17-23(25-18-26-24)20-6-4-7-21(16-20)31-2/h4,6-11,16-18H,3,5,12-15H2,1-2H3 |
| InChIKey | AMPZMLFNPUDKMY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |