C21H21IN4O3S — CID 121060684
3-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]-6-(3-methoxyphenyl)pyridazine (PubChem CID 121060684) has the molecular formula C21H21IN4O3S and a molecular weight of 536.40 g/mol. Its IUPAC name is 3-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]-6-(3-methoxyphenyl)pyridazine.
| Compound Name | 3-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]-6-(3-methoxyphenyl)pyridazine |
|---|---|
| PubChem CID | 121060684 |
| Molecular Formula | C21H21IN4O3S |
| Molecular Weight | 536.40 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | 3-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]-6-(3-methoxyphenyl)pyridazine |
| SMILES | COc1cccc(-c2ccc(N3CCN(S(=O)(=O)c4ccc(I)cc4)CC3)nn2)c1 |
| InChI | InChI=1S/C21H21IN4O3S/c1-29-18-4-2-3-16(15-18)20-9-10-21(24-23-20)25-11-13-26(14-12-25)30(27,28)19-7-5-17(22)6-8-19/h2-10,15H,11-14H2,1H3 |
| InChIKey | VJXWHNZYQQROIV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|