C27H34N4O6S — CID 121060832
3-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-6-(3,4,5-trimethoxyphenyl)pyridazine (PubChem CID 121060832) has the molecular formula C27H34N4O6S and a molecular weight of 542.66 g/mol. Its IUPAC name is 3-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-6-(3,4,5-trimethoxyphenyl)pyridazine.
| Compound Name | 3-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-6-(3,4,5-trimethoxyphenyl)pyridazine |
|---|---|
| PubChem CID | 121060832 |
| Molecular Formula | C27H34N4O6S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 3-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-6-(3,4,5-trimethoxyphenyl)pyridazine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN(c3ccc(-c4cc(OC)c(OC)c(OC)c4)nn3)CC2)cc1 |
| InChI | InChI=1S/C27H34N4O6S/c1-5-6-17-37-21-7-9-22(10-8-21)38(32,33)31-15-13-30(14-16-31)26-12-11-23(28-29-26)20-18-24(34-2)27(36-4)25(19-20)35-3/h7-12,18-19H,5-6,13-17H2,1-4H3 |
| InChIKey | FBGAMOGLIGIDCZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|