C20H29N5O3S — CID 91968767
6-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-N,N-dimethylpyridazin-4-amine (PubChem CID 91968767) has the molecular formula C20H29N5O3S and a molecular weight of 419.55 g/mol. Its IUPAC name is 6-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-N,N-dimethylpyridazin-4-amine.
| Compound Name | 6-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-N,N-dimethylpyridazin-4-amine |
|---|---|
| PubChem CID | 91968767 |
| Molecular Formula | C20H29N5O3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 6-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]-N,N-dimethylpyridazin-4-amine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN(c3cc(N(C)C)cnn3)CC2)cc1 |
| InChI | InChI=1S/C20H29N5O3S/c1-4-5-14-28-18-6-8-19(9-7-18)29(26,27)25-12-10-24(11-13-25)20-15-17(23(2)3)16-21-22-20/h6-9,15-16H,4-5,10-14H2,1-3H3 |
| InChIKey | MFPRABSJBMMGRI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|