C22H31N5O4S — CID 91968904
4-[6-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine (PubChem CID 91968904) has the molecular formula C22H31N5O4S and a molecular weight of 461.59 g/mol. Its IUPAC name is 4-[6-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine.
| Compound Name | 4-[6-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine |
|---|---|
| PubChem CID | 91968904 |
| Molecular Formula | C22H31N5O4S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 4-[6-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN(c3cc(N4CCOCC4)cnn3)CC2)cc1 |
| InChI | InChI=1S/C22H31N5O4S/c1-2-3-14-31-20-4-6-21(7-5-20)32(28,29)27-10-8-26(9-11-27)22-17-19(18-23-24-22)25-12-15-30-16-13-25/h4-7,17-18H,2-3,8-16H2,1H3 |
| InChIKey | QVLOZZCLASSLKY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|