C19H22F3N5O3S — CID 91968933
4-[6-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine (PubChem CID 91968933) has the molecular formula C19H22F3N5O3S and a molecular weight of 457.48 g/mol. Its IUPAC name is 4-[6-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine.
| Compound Name | 4-[6-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine |
|---|---|
| PubChem CID | 91968933 |
| Molecular Formula | C19H22F3N5O3S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-[6-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCN(c2cc(N3CCOCC3)cnn2)CC1 |
| InChI | InChI=1S/C19H22F3N5O3S/c20-19(21,22)15-1-3-17(4-2-15)31(28,29)27-7-5-26(6-8-27)18-13-16(14-23-24-18)25-9-11-30-12-10-25/h1-4,13-14H,5-12H2 |
| InChIKey | KOMDUVXNVXRIBW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |