C14H23N5O3S — CID 91969061
4-[5-(4-ethylsulfonylpiperazin-1-yl)pyridazin-3-yl]morpholine (PubChem CID 91969061) has the molecular formula C14H23N5O3S and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-[5-(4-ethylsulfonylpiperazin-1-yl)pyridazin-3-yl]morpholine.
| Compound Name | 4-[5-(4-ethylsulfonylpiperazin-1-yl)pyridazin-3-yl]morpholine |
|---|---|
| PubChem CID | 91969061 |
| Molecular Formula | C14H23N5O3S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-[5-(4-ethylsulfonylpiperazin-1-yl)pyridazin-3-yl]morpholine |
| SMILES | CCS(=O)(=O)N1CCN(c2cnnc(N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C14H23N5O3S/c1-2-23(20,21)19-5-3-17(4-6-19)13-11-14(16-15-12-13)18-7-9-22-10-8-18/h11-12H,2-10H2,1H3 |
| InChIKey | QUMXTGFTHGTISW-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |