C22H31N5O5S — CID 91968919
4-[6-[4-(2,5-diethoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine (PubChem CID 91968919) has the molecular formula C22H31N5O5S and a molecular weight of 477.59 g/mol. Its IUPAC name is 4-[6-[4-(2,5-diethoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine.
| Compound Name | 4-[6-[4-(2,5-diethoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine |
|---|---|
| PubChem CID | 91968919 |
| Molecular Formula | C22H31N5O5S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 4-[6-[4-(2,5-diethoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-4-yl]morpholine |
| SMILES | CCOc1ccc(OCC)c(S(=O)(=O)N2CCN(c3cc(N4CCOCC4)cnn3)CC2)c1 |
| InChI | InChI=1S/C22H31N5O5S/c1-3-31-19-5-6-20(32-4-2)21(16-19)33(28,29)27-9-7-26(8-10-27)22-15-18(17-23-24-22)25-11-13-30-14-12-25/h5-6,15-17H,3-4,7-14H2,1-2H3 |
| InChIKey | ORYPYYUFBDXKNC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |