C18H24N4O4S — CID 121060962
3-[4-(2,5-diethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine (PubChem CID 121060962) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-[4-(2,5-diethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-[4-(2,5-diethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 121060962 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-[4-(2,5-diethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine |
| SMILES | CCOc1ccc(OCC)c(S(=O)(=O)N2CCN(c3cccnn3)CC2)c1 |
| InChI | InChI=1S/C18H24N4O4S/c1-3-25-15-7-8-16(26-4-2)17(14-15)27(23,24)22-12-10-21(11-13-22)18-6-5-9-19-20-18/h5-9,14H,3-4,10-13H2,1-2H3 |
| InChIKey | BEUBJOBZGXVSBT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |