About 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine
3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine (PubChem CID 121053243) has the molecular formula C23H34N6O4S
and a molecular weight of 490.63 g/mol. Its IUPAC name is 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine.
Molecular Properties
| Compound Name | 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine |
| PubChem CID | 121053243 |
| Molecular Formula | C23H34N6O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(c3ccc(N4CCN(C)CC4)nn3)CC2)c(OCC)c1 |
| InChI | InChI=1S/C23H34N6O4S/c1-4-32-19-6-7-21(20(18-19)33-5-2)34(30,31)29-16-14-28(15-17-29)23-9-8-22(24-25-23)27-12-10-26(3)11-13-27/h6-9,18H,4-5,10-17H2,1-3H3 |
| InChIKey | CYLVZFCKLKHZKN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine?
The IUPAC name of 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine (CID 121053243) is 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine.
What is the SMILES notation for 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine?
The canonical SMILES for 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine is CCOc1ccc(S(=O)(=O)N2CCN(c3ccc(N4CCN(C)CC4)nn3)CC2)c(OCC)c1.
What is the InChIKey of 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine?
The InChIKey is CYLVZFCKLKHZKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34N6O4S/c1-4-32-19-6-7-21(20(18-19)33-5-2)34(30,31)29-16-14-28(15-17-29)23-9-8-22(24-25-23)27-12-10-26(3)11-13-27/h6-9,18H,4-5,10-17H2,1-3H3.
What are the key properties of 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine?
3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine has a molecular weight of 490.63 g/mol, XLogP of 1.54, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyridazine is sourced from PubChem (CID 121053243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).