C19H24N4O3S — CID 122279744
3-cyclopropyl-6-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine (PubChem CID 122279744) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-cyclopropyl-6-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-cyclopropyl-6-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 122279744 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-cyclopropyl-6-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(c3ccc(C4CC4)nn3)CC2)cc1 |
| InChI | InChI=1S/C19H24N4O3S/c1-2-26-16-5-7-17(8-6-16)27(24,25)23-13-11-22(12-14-23)19-10-9-18(20-21-19)15-3-4-15/h5-10,15H,2-4,11-14H2,1H3 |
| InChIKey | QOWZNKCPITXLTI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |