C16H20ClN5O3S — CID 31537662
4-chloro-6-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pyrimidin-2-amine (PubChem CID 31537662) has the molecular formula C16H20ClN5O3S and a molecular weight of 397.89 g/mol. Its IUPAC name is 4-chloro-6-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 31537662 |
| Molecular Formula | C16H20ClN5O3S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 4-chloro-6-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]pyrimidin-2-amine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(c3cc(Cl)nc(N)n3)CC2)cc1 |
| InChI | InChI=1S/C16H20ClN5O3S/c1-2-25-12-3-5-13(6-4-12)26(23,24)22-9-7-21(8-10-22)15-11-14(17)19-16(18)20-15/h3-6,11H,2,7-10H2,1H3,(H2,18,19,20) |
| InChIKey | KAJVBTGITUODPJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |