C16H20ClN5O2S — CID 31537658
4-chloro-6-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]pyrimidin-2-amine (PubChem CID 31537658) has the molecular formula C16H20ClN5O2S and a molecular weight of 381.89 g/mol. Its IUPAC name is 4-chloro-6-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 31537658 |
| Molecular Formula | C16H20ClN5O2S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 4-chloro-6-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]pyrimidin-2-amine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(c3cc(Cl)nc(N)n3)CC2)c1 |
| InChI | InChI=1S/C16H20ClN5O2S/c1-11-3-4-12(2)13(9-11)25(23,24)22-7-5-21(6-8-22)15-10-14(17)19-16(18)20-15/h3-4,9-10H,5-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | UKLRYXAGNHZAHH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |