C14H21NO5S2 — CID 90585227
1-(4-ethoxyphenyl)sulfonyl-4-methylsulfonylpiperidine (PubChem CID 90585227) has the molecular formula C14H21NO5S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)sulfonyl-4-methylsulfonylpiperidine.
| Compound Name | 1-(4-ethoxyphenyl)sulfonyl-4-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 90585227 |
| Molecular Formula | C14H21NO5S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-(4-ethoxyphenyl)sulfonyl-4-methylsulfonylpiperidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C14H21NO5S2/c1-3-20-12-4-6-14(7-5-12)22(18,19)15-10-8-13(9-11-15)21(2,16)17/h4-7,13H,3,8-11H2,1-2H3 |
| InChIKey | YNJYOLRJDNYEOJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |