C18H30NO6PS — CID 141058059
4-(diethoxyphosphorylmethyl)-1-(4-ethoxyphenyl)sulfonylpiperidine (PubChem CID 141058059) has the molecular formula C18H30NO6PS and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-(diethoxyphosphorylmethyl)-1-(4-ethoxyphenyl)sulfonylpiperidine.
| Compound Name | 4-(diethoxyphosphorylmethyl)-1-(4-ethoxyphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 141058059 |
| Molecular Formula | C18H30NO6PS |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-(diethoxyphosphorylmethyl)-1-(4-ethoxyphenyl)sulfonylpiperidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(CP(=O)(OCC)OCC)CC2)cc1 |
| InChI | InChI=1S/C18H30NO6PS/c1-4-23-17-7-9-18(10-8-17)27(21,22)19-13-11-16(12-14-19)15-26(20,24-5-2)25-6-3/h7-10,16H,4-6,11-15H2,1-3H3 |
| InChIKey | YNWSYNKLTLDUOV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|