C17H26N2O3S — CID 95751370
1-(cyclopropylmethyl)-4-(4-ethoxyphenyl)sulfonyl-1,4-diazepane (PubChem CID 95751370) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-(4-ethoxyphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(cyclopropylmethyl)-4-(4-ethoxyphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 95751370 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-(4-ethoxyphenyl)sulfonyl-1,4-diazepane |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCCN(CC3CC3)CC2)cc1 |
| InChI | InChI=1S/C17H26N2O3S/c1-2-22-16-6-8-17(9-7-16)23(20,21)19-11-3-10-18(12-13-19)14-15-4-5-15/h6-9,15H,2-5,10-14H2,1H3 |
| InChIKey | UEYONNCFXFLXLD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |