C18H20N6O6S — CID 122279758
3-cyclopropyl-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyridazine (PubChem CID 122279758) has the molecular formula C18H20N6O6S and a molecular weight of 448.46 g/mol. Its IUPAC name is 3-cyclopropyl-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-cyclopropyl-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 122279758 |
| Molecular Formula | C18H20N6O6S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-cyclopropyl-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyridazine |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)N2CCN(c3ccc(C4CC4)nn3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N6O6S/c1-12-16(23(25)26)10-14(11-17(12)24(27)28)31(29,30)22-8-6-21(7-9-22)18-5-4-15(19-20-18)13-2-3-13/h4-5,10-11,13H,2-3,6-9H2,1H3 |
| InChIKey | DVRWSCCCFUICCR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 152.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|